C27H26O5S — CID 101234267
S-[[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]methyl] ethanethioate (PubChem CID 101234267) has the molecular formula C27H26O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is S-[[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]methyl] ethanethioate.
| Compound Name | S-[[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 101234267 |
| Molecular Formula | C27H26O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | S-[[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]methyl] ethanethioate |
| SMILES | COCOc1ccc2ccccc2c1-c1c(OCOC)c(CSC(C)=O)cc2ccccc12 |
| InChI | InChI=1S/C27H26O5S/c1-18(28)33-15-21-14-20-9-5-7-11-23(20)26(27(21)32-17-30-3)25-22-10-6-4-8-19(22)12-13-24(25)31-16-29-2/h4-14H,15-17H2,1-3H3 |
| InChIKey | KPNQTTHQMOGSFU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|