C22H24BP — CID 139090387
(1,1-diphenylprop-1-en-2-yl-methyl-phenylphosphaniumyl)boranuide (PubChem CID 139090387) has the molecular formula C22H24BP and a molecular weight of 330.22 g/mol. Its IUPAC name is (1,1-diphenylprop-1-en-2-yl-methyl-phenylphosphaniumyl)boranuide.
| Compound Name | (1,1-diphenylprop-1-en-2-yl-methyl-phenylphosphaniumyl)boranuide |
|---|---|
| PubChem CID | 139090387 |
| Molecular Formula | C22H24BP |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1,1-diphenylprop-1-en-2-yl-methyl-phenylphosphaniumyl)boranuide |
| SMILES | [BH3-][P@+](C)(C(C)=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24BP/c1-18(24(2,23)21-16-10-5-11-17-21)22(19-12-6-3-7-13-19)20-14-8-4-9-15-20/h3-17H,1-2,23H3/t24-/m1/s1 |
| InChIKey | KWESZROPKAOCJU-XMMPIXPASA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|