C30H42N2O12 — CID 139091502
methyl (1S,2R,6S,9S)-9-tert-butyl-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 139091502) has the molecular formula C30H42N2O12 and a molecular weight of 622.67 g/mol. Its IUPAC name is methyl (1S,2R,6S,9S)-9-tert-butyl-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1S,2R,6S,9S)-9-tert-butyl-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 139091502 |
| Molecular Formula | C30H42N2O12 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | methyl (1S,2R,6S,9S)-9-tert-butyl-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@H]1CC(=O)O[C@]12C.COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@H]1CC(=O)O[C@]12C |
| InChI | InChI=1S/2C15H21NO6/c2*1-13(2,3)11-16-10(18)8-6-9(17)22-14(8,4)15(16,7-21-11)12(19)20-5/h2*8,11H,6-7H2,1-5H3/t2*8-,11+,14-,15-/m11/s1 |
| InChIKey | ANYUMOWNULGXMW-CUZMWFCISA-N |
| XLogP | 0.93 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|