C28H34N2O14 — CID 139091980
methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate (PubChem CID 139091980) has the molecular formula C28H34N2O14 and a molecular weight of 622.58 g/mol. Its IUPAC name is methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate.
| Compound Name | methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate |
|---|---|
| PubChem CID | 139091980 |
| Molecular Formula | C28H34N2O14 |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@@](C)(C(C)=O)N1C(=O)[C@@]1(CCOC1=O)C2.COC(=O)[C@]12CO[C@@](C)(C(C)=O)N1C(=O)[C@@]1(CCOC1=O)C2 |
| InChI | InChI=1S/2C14H17NO7/c2*1-8(16)12(2)15-9(17)13(4-5-21-10(13)18)6-14(15,7-22-12)11(19)20-3/h2*4-7H2,1-3H3/t2*12-,13+,14-/m00/s1 |
| InChIKey | UKRYFGJOKCDTQV-FEHBAXHNSA-N |
| XLogP | -1.20 |
| TPSA | 198.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|