C14H17NO7 — CID 53497199
methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate (PubChem CID 53497199) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate.
| Compound Name | methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate |
|---|---|
| PubChem CID | 53497199 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | methyl (3S,6S,7aS)-3-acetyl-3-methyl-2',5-dioxospiro[1,7-dihydropyrrolo[1,2-c][1,3]oxazole-6,3'-oxolane]-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@@](C)(C(C)=O)N1C(=O)[C@@]1(CCOC1=O)C2 |
| InChI | InChI=1S/C14H17NO7/c1-8(16)12(2)15-9(17)13(4-5-21-10(13)18)6-14(15,7-22-12)11(19)20-3/h4-7H2,1-3H3/t12-,13+,14-/m0/s1 |
| InChIKey | XSDLUYUFBVGJHN-MJBXVCDLSA-N |
| XLogP | -0.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|