C13H17NO7 — CID 53497339
dimethyl (3R,6R,7aR)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate (PubChem CID 53497339) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is dimethyl (3R,6R,7aR)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate.
| Compound Name | dimethyl (3R,6R,7aR)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
|---|---|
| PubChem CID | 53497339 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | dimethyl (3R,6R,7aR)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(C(=O)OC)CO[C@](C)(C(C)=O)N2C1=O |
| InChI | InChI=1S/C13H17NO7/c1-7(15)12(2)14-9(16)8(10(17)19-3)5-13(14,6-21-12)11(18)20-4/h8H,5-6H2,1-4H3/t8-,12-,13-/m1/s1 |
| InChIKey | DWVPBHCJUWLRNW-BZHVJNSISA-N |
| XLogP | -0.74 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|