C15H19NO9 — CID 53497337
trimethyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate (PubChem CID 53497337) has the molecular formula C15H19NO9 and a molecular weight of 357.32 g/mol. Its IUPAC name is trimethyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate.
| Compound Name | trimethyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate |
|---|---|
| PubChem CID | 53497337 |
| Molecular Formula | C15H19NO9 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | trimethyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7,7a-tricarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N2[C@](C)(C(C)=O)OC[C@]2(C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C15H19NO9/c1-7(17)14(2)16-10(18)8(11(19)22-3)9(12(20)23-4)15(16,6-25-14)13(21)24-5/h8-9H,6H2,1-5H3/t8-,9+,14+,15-/m1/s1 |
| InChIKey | GKHORILQJMCSGV-UTBFZLOTSA-N |
| XLogP | -1.35 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|