C15H18F3NO7 — CID 53497336
6-O-ethyl 7a-O-methyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-7-(trifluoromethyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate (PubChem CID 53497336) has the molecular formula C15H18F3NO7 and a molecular weight of 381.30 g/mol. Its IUPAC name is 6-O-ethyl 7a-O-methyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-7-(trifluoromethyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate.
| Compound Name | 6-O-ethyl 7a-O-methyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-7-(trifluoromethyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
|---|---|
| PubChem CID | 53497336 |
| Molecular Formula | C15H18F3NO7 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-O-ethyl 7a-O-methyl (3S,6R,7R,7aS)-3-acetyl-3-methyl-5-oxo-7-(trifluoromethyl)-6,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N2[C@](C)(C(C)=O)OC[C@]2(C(=O)OC)[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO7/c1-5-25-11(22)8-9(15(16,17)18)14(12(23)24-4)6-26-13(3,7(2)20)19(14)10(8)21/h8-9H,5-6H2,1-4H3/t8-,9-,13+,14-/m1/s1 |
| InChIKey | VRYLHVSSMLSAFK-NHPAQXRMSA-N |
| XLogP | 0.43 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|