C12H17NO6 — CID 59077841
(3S,7aR)-7a-methoxycarbonyl-5-oxo-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid (PubChem CID 59077841) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (3S,7aR)-7a-methoxycarbonyl-5-oxo-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid.
| Compound Name | (3S,7aR)-7a-methoxycarbonyl-5-oxo-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 59077841 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (3S,7aR)-7a-methoxycarbonyl-5-oxo-3-propan-2-yl-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)C)N1C(=O)C(C(=O)O)C2 |
| InChI | InChI=1S/C12H17NO6/c1-6(2)9-13-8(14)7(10(15)16)4-12(13,5-19-9)11(17)18-3/h6-7,9H,4-5H2,1-3H3,(H,15,16)/t7?,9-,12+/m0/s1 |
| InChIKey | WKLZNUIBGOEBRV-XIYAFUFESA-N |
| XLogP | -0.16 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|