C13H19NO6 — CID 11140659
(3S,7aR)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid (PubChem CID 11140659) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (3S,7aR)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid.
| Compound Name | (3S,7aR)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 11140659 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3S,7aR)-3-tert-butyl-7a-methoxycarbonyl-5-oxo-1,3,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylic acid |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)C(C(=O)O)C2 |
| InChI | InChI=1S/C13H19NO6/c1-12(2,3)10-14-8(15)7(9(16)17)5-13(14,6-20-10)11(18)19-4/h7,10H,5-6H2,1-4H3,(H,16,17)/t7?,10-,13+/m0/s1 |
| InChIKey | CCHVMRXLGHGIGU-GLWCPXLYSA-N |
| XLogP | 0.23 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|