C19H16FNO2 — CID 139092977
methyl (4S)-1-(4-fluorophenyl)-4-phenyl-4H-pyridine-3-carboxylate (PubChem CID 139092977) has the molecular formula C19H16FNO2 and a molecular weight of 309.34 g/mol. Its IUPAC name is methyl (4S)-1-(4-fluorophenyl)-4-phenyl-4H-pyridine-3-carboxylate.
| Compound Name | methyl (4S)-1-(4-fluorophenyl)-4-phenyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139092977 |
| Molecular Formula | C19H16FNO2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl (4S)-1-(4-fluorophenyl)-4-phenyl-4H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=CN(c2ccc(F)cc2)C=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H16FNO2/c1-23-19(22)18-13-21(16-9-7-15(20)8-10-16)12-11-17(18)14-5-3-2-4-6-14/h2-13,17H,1H3/t17-/m0/s1 |
| InChIKey | PZSYYFYNFLFNHT-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |