C34H40N2O8 — CID 139093535
(6R,11E,17R,27S,28S)-27,28-bis[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,18-dioxa-8,15-diazahexacyclo[20.2.2.16,8.115,17.02,6.017,21]octacosa-1(24),2,11,20,22,25-hexaene-7,16-dione (PubChem CID 139093535) has the molecular formula C34H40N2O8 and a molecular weight of 604.70 g/mol. Its IUPAC name is (6R,11E,17R,27S,28S)-27,28-bis[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,18-dioxa-8,15-diazahexacyclo[20.2.2.16,8.115,17.02,6.017,21]octacosa-1(24),2,11,20,22,25-hexaene-7,16-dione.
| Compound Name | (6R,11E,17R,27S,28S)-27,28-bis[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,18-dioxa-8,15-diazahexacyclo[20.2.2.16,8.115,17.02,6.017,21]octacosa-1(24),2,11,20,22,25-hexaene-7,16-dione |
|---|---|
| PubChem CID | 139093535 |
| Molecular Formula | C34H40N2O8 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (6R,11E,17R,27S,28S)-27,28-bis[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,18-dioxa-8,15-diazahexacyclo[20.2.2.16,8.115,17.02,6.017,21]octacosa-1(24),2,11,20,22,25-hexaene-7,16-dione |
| SMILES | CC1(C)OC[C@H]([C@@H]2N3CC/C=C/CCN4C(=O)[C@]5(OCC=C5c5ccc(cc5)C5=CCO[C@]52C3=O)[C@@H]4[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C34H40N2O8/c1-31(2)41-19-25(43-31)27-33-23(13-17-39-33)21-9-11-22(12-10-21)24-14-18-40-34(24)28(26-20-42-32(3,4)44-26)36(30(34)38)16-8-6-5-7-15-35(27)29(33)37/h5-6,9-14,25-28H,7-8,15-20H2,1-4H3/b6-5+/t25-,26-,27+,28+,33-,34-/m1/s1 |
| InChIKey | LWXSJJPJXOHUQV-FPRPNHQVSA-N |
| XLogP | 3.07 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|