C27H35NO9 — CID 10962354
methyl (E,4S)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3R,4S)-3-methoxy-2-oxo-4-[(2R,3R)-3-phenyloxiran-2-yl]azetidin-1-yl]but-2-enoate (PubChem CID 10962354) has the molecular formula C27H35NO9 and a molecular weight of 517.58 g/mol. Its IUPAC name is methyl (E,4S)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3R,4S)-3-methoxy-2-oxo-4-[(2R,3R)-3-phenyloxiran-2-yl]azetidin-1-yl]but-2-enoate.
| Compound Name | methyl (E,4S)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3R,4S)-3-methoxy-2-oxo-4-[(2R,3R)-3-phenyloxiran-2-yl]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 10962354 |
| Molecular Formula | C27H35NO9 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | methyl (E,4S)-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3R,4S)-3-methoxy-2-oxo-4-[(2R,3R)-3-phenyloxiran-2-yl]azetidin-1-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]([C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1)N1C(=O)[C@H](OC)[C@@H]1[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H35NO9/c1-26(2)33-14-17(35-26)22-21(36-27(3,4)37-22)16(12-13-18(29)31-5)28-19(24(32-6)25(28)30)23-20(34-23)15-10-8-7-9-11-15/h7-13,16-17,19-24H,14H2,1-6H3/b13-12+/t16-,17+,19-,20+,21+,22+,23+,24+/m0/s1 |
| InChIKey | KRFYYXYMEOTGJQ-OHLBHZBISA-N |
| XLogP | 2.12 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|