C20H29BrO4Si — CID 139093562
3-[(1S,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]oxy-4-methoxybenzaldehyde (PubChem CID 139093562) has the molecular formula C20H29BrO4Si and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[(1S,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]oxy-4-methoxybenzaldehyde.
| Compound Name | 3-[(1S,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]oxy-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 139093562 |
| Molecular Formula | C20H29BrO4Si |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 3-[(1S,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-yl]oxy-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC=C1Br |
| InChI | InChI=1S/C20H29BrO4Si/c1-20(2,3)26(5,6)25-15-8-9-16(21)18(12-15)24-19-11-14(13-22)7-10-17(19)23-4/h7,9-11,13,15,18H,8,12H2,1-6H3/t15-,18-/m0/s1 |
| InChIKey | DLCSVDDCWKZVIB-YJBOKZPZSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|