C17H25NO4 — CID 139093777
(1S)-1-[(3aR,4R,6aS)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol (PubChem CID 139093777) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (1S)-1-[(3aR,4R,6aS)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(3aR,4R,6aS)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 139093777 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (1S)-1-[(3aR,4R,6aS)-2,2-dimethyl-5-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol |
| SMILES | C[C@@H](c1ccccc1)N1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1[C@H](O)CO |
| InChI | InChI=1S/C17H25NO4/c1-11(12-7-5-4-6-8-12)18-9-14-16(15(18)13(20)10-19)22-17(2,3)21-14/h4-8,11,13-16,19-20H,9-10H2,1-3H3/t11-,13+,14-,15+,16-/m0/s1 |
| InChIKey | UAYPJXCREUAOCN-HSZNGYFJSA-N |
| XLogP | 1.31 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |