C19H17NO4 — CID 139095424
1-(3-nitrophenyl)-2-[(1S,3S)-3-prop-2-enyl-1,3-dihydro-2-benzofuran-1-yl]ethanone (PubChem CID 139095424) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-[(1S,3S)-3-prop-2-enyl-1,3-dihydro-2-benzofuran-1-yl]ethanone.
| Compound Name | 1-(3-nitrophenyl)-2-[(1S,3S)-3-prop-2-enyl-1,3-dihydro-2-benzofuran-1-yl]ethanone |
|---|---|
| PubChem CID | 139095424 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(3-nitrophenyl)-2-[(1S,3S)-3-prop-2-enyl-1,3-dihydro-2-benzofuran-1-yl]ethanone |
| SMILES | C=CC[C@@H]1O[C@@H](CC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C19H17NO4/c1-2-6-18-15-9-3-4-10-16(15)19(24-18)12-17(21)13-7-5-8-14(11-13)20(22)23/h2-5,7-11,18-19H,1,6,12H2/t18-,19-/m0/s1 |
| InChIKey | GIIKYPJEIKNOOX-OALUTQOASA-N |
| XLogP | 4.56 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|