C25H30Cl3F3N4O3S — CID 139108716
chloroform;(2E)-1-methyl-2-[(1-methyl-3-propan-2-ylbenzimidazol-1-ium-2-yl)methylidene]-3-propan-2-ylbenzimidazole;trifluoromethanesulfonate (PubChem CID 139108716) has the molecular formula C25H30Cl3F3N4O3S and a molecular weight of 629.96 g/mol. Its IUPAC name is chloroform;(2E)-1-methyl-2-[(1-methyl-3-propan-2-ylbenzimidazol-1-ium-2-yl)methylidene]-3-propan-2-ylbenzimidazole;trifluoromethanesulfonate.
| Compound Name | chloroform;(2E)-1-methyl-2-[(1-methyl-3-propan-2-ylbenzimidazol-1-ium-2-yl)methylidene]-3-propan-2-ylbenzimidazole;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139108716 |
| Molecular Formula | C25H30Cl3F3N4O3S |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | chloroform;(2E)-1-methyl-2-[(1-methyl-3-propan-2-ylbenzimidazol-1-ium-2-yl)methylidene]-3-propan-2-ylbenzimidazole;trifluoromethanesulfonate |
| SMILES | CC(C)N1/C(=C/c2n(C(C)C)c3ccccc3[n+]2C)N(C)c2ccccc21.ClC(Cl)Cl.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H29N4.CHCl3.CHF3O3S/c1-16(2)26-20-13-9-7-11-18(20)24(5)22(26)15-23-25(6)19-12-8-10-14-21(19)27(23)17(3)4;2-1(3)4;2-1(3,4)8(5,6)7/h7-17H,1-6H3;1H;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | TWPGFAFGFJGITN-UHFFFAOYSA-M |
| XLogP | 6.75 |
| TPSA | 72.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|