About 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole
2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole (PubChem CID 5308283) has the molecular formula C13H17N3O2S
and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
| PubChem CID | 5308283 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole |
| SMILES | CCCS(=O)(=O)N1CCn2c(nc3ccccc32)C1 |
| InChI | InChI=1S/C13H17N3O2S/c1-2-9-19(17,18)15-7-8-16-12-6-4-3-5-11(12)14-13(16)10-15/h3-6H,2,7-10H2,1H3 |
| InChIKey | CGWRFXPAJVKACH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The IUPAC name of 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole (CID 5308283) is 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole.
What is the SMILES notation for 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The canonical SMILES for 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole is CCCS(=O)(=O)N1CCn2c(nc3ccccc32)C1.
What is the InChIKey of 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
The InChIKey is CGWRFXPAJVKACH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-2-9-19(17,18)15-7-8-16-12-6-4-3-5-11(12)14-13(16)10-15/h3-6H,2,7-10H2,1H3.
What are the key properties of 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole?
2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole has a molecular weight of 279.36 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfonyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole is sourced from PubChem (CID 5308283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).