C28H36Cl2F3N2O3PS — CID 139109520
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichlorophosphane;trifluoromethanesulfonate (PubChem CID 139109520) has the molecular formula C28H36Cl2F3N2O3PS and a molecular weight of 639.55 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichlorophosphane;trifluoromethanesulfonate.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichlorophosphane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139109520 |
| Molecular Formula | C28H36Cl2F3N2O3PS |
| Molecular Weight | 639.55 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichlorophosphane;trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1P(Cl)Cl.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H36Cl2N2P.CHF3O3S/c1-17(2)21-11-9-12-22(18(3)4)25(21)30-15-16-31(27(30)32(28)29)26-23(19(5)6)13-10-14-24(26)20(7)8;2-1(3,4)8(5,6)7/h9-20H,1-8H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ONKKDGMWNXIUNM-UHFFFAOYSA-M |
| XLogP | 8.71 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.55 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|