C28H36BCl2F3N2O3S — CID 139109589
[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichloro-(trifluoromethylsulfonyloxy)boranuide (PubChem CID 139109589) has the molecular formula C28H36BCl2F3N2O3S and a molecular weight of 619.39 g/mol. Its IUPAC name is [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichloro-(trifluoromethylsulfonyloxy)boranuide.
| Compound Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichloro-(trifluoromethylsulfonyloxy)boranuide |
|---|---|
| PubChem CID | 139109589 |
| Molecular Formula | C28H36BCl2F3N2O3S |
| Molecular Weight | 619.39 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]-dichloro-(trifluoromethylsulfonyloxy)boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[B-](Cl)(Cl)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C28H36BCl2F3N2O3S/c1-17(2)21-11-9-12-22(18(3)4)25(21)35-15-16-36(26-23(19(5)6)13-10-14-24(26)20(7)8)27(35)29(30,31)39-40(37,38)28(32,33)34/h9-20H,1-8H3 |
| InChIKey | FBZQNNATVXCIAO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.39 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|