C31H18F6N2O — CID 139113527
(1S,15S)-7,21-bis(trifluoromethyl)-3,17-diazaoctacyclo[13.13.1.12,10.116,24.04,9.018,23.014,31.028,30]hentriaconta-2(31),3,5,7,9,11,13,16(30),17,19,21,23,25,27-tetradecaene;hydrate (PubChem CID 139113527) has the molecular formula C31H18F6N2O and a molecular weight of 548.49 g/mol. Its IUPAC name is (1S,15S)-7,21-bis(trifluoromethyl)-3,17-diazaoctacyclo[13.13.1.12,10.116,24.04,9.018,23.014,31.028,30]hentriaconta-2(31),3,5,7,9,11,13,16(30),17,19,21,23,25,27-tetradecaene;hydrate.
| Compound Name | (1S,15S)-7,21-bis(trifluoromethyl)-3,17-diazaoctacyclo[13.13.1.12,10.116,24.04,9.018,23.014,31.028,30]hentriaconta-2(31),3,5,7,9,11,13,16(30),17,19,21,23,25,27-tetradecaene;hydrate |
|---|---|
| PubChem CID | 139113527 |
| Molecular Formula | C31H18F6N2O |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | (1S,15S)-7,21-bis(trifluoromethyl)-3,17-diazaoctacyclo[13.13.1.12,10.116,24.04,9.018,23.014,31.028,30]hentriaconta-2(31),3,5,7,9,11,13,16(30),17,19,21,23,25,27-tetradecaene;hydrate |
| SMILES | FC(F)(F)c1ccc2nc3c4c(cccc4c2c1)[C@@H]1C[C@H]3c2cccc3c2c1nc1ccc(C(F)(F)F)cc13.O |
| InChI | InChI=1S/C31H16F6N2.H2O/c32-30(33,34)14-7-9-24-20(11-14)16-3-1-5-18-22-13-23(29(38-24)26(16)18)19-6-2-4-17-21-12-15(31(35,36)37)8-10-25(21)39-28(22)27(17)19;/h1-12,22-23H,13H2;1H2/t22-,23-;/m0./s1 |
| InChIKey | FWRMWOBNGMVAGO-SJEIDVEUSA-N |
| XLogP | 8.28 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|