C25H23NO4S — CID 139116478
[(3R,4R)-4-benzoyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-phenylmethanone (PubChem CID 139116478) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is [(3R,4R)-4-benzoyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-phenylmethanone.
| Compound Name | [(3R,4R)-4-benzoyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139116478 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [(3R,4R)-4-benzoyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C(=O)c3ccccc3)[C@@H](C(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H23NO4S/c1-18-12-14-21(15-13-18)31(29,30)26-16-22(24(27)19-8-4-2-5-9-19)23(17-26)25(28)20-10-6-3-7-11-20/h2-15,22-23H,16-17H2,1H3/t22-,23-/m0/s1 |
| InChIKey | KOQKYSVQTAWXEY-GOTSBHOMSA-N |
| XLogP | 4.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |