C35H35BrN4O5S — CID 139116828
3-(6-bromo-1H-indol-3-yl)-6-[1-(4-methylphenyl)sulfonylindol-3-yl]-1H-pyrazin-2-one;oxolane (PubChem CID 139116828) has the molecular formula C35H35BrN4O5S and a molecular weight of 703.66 g/mol. Its IUPAC name is 3-(6-bromo-1H-indol-3-yl)-6-[1-(4-methylphenyl)sulfonylindol-3-yl]-1H-pyrazin-2-one;oxolane.
| Compound Name | 3-(6-bromo-1H-indol-3-yl)-6-[1-(4-methylphenyl)sulfonylindol-3-yl]-1H-pyrazin-2-one;oxolane |
|---|---|
| PubChem CID | 139116828 |
| Molecular Formula | C35H35BrN4O5S |
| Molecular Weight | 703.66 g/mol |
| Exact Mass | 702.15 |
| IUPAC Name | 3-(6-bromo-1H-indol-3-yl)-6-[1-(4-methylphenyl)sulfonylindol-3-yl]-1H-pyrazin-2-one;oxolane |
| SMILES | C1CCOC1.C1CCOC1.Cc1ccc(S(=O)(=O)n2cc(-c3cnc(-c4c[nH]c5cc(Br)ccc45)c(=O)[nH]3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H19BrN4O3S.2C4H8O/c1-16-6-9-18(10-7-16)36(34,35)32-15-22(20-4-2-3-5-25(20)32)24-14-30-26(27(33)31-24)21-13-29-23-12-17(28)8-11-19(21)23;2*1-2-4-5-3-1/h2-15,29H,1H3,(H,31,33);2*1-4H2 |
| InChIKey | VUGWQCOLQLCGFC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.66 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |