C23H36O5SSi — CID 139117922
[(1S,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-yl] acetate (PubChem CID 139117922) has the molecular formula C23H36O5SSi and a molecular weight of 452.69 g/mol. Its IUPAC name is [(1S,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 139117922 |
| Molecular Formula | C23H36O5SSi |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [(1S,2S,6S,7S)-3-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylcyclohept-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CC=C(S(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H36O5SSi/c1-16-20(28-30(7,8)23(4,5)6)14-15-21(17(2)22(16)27-18(3)24)29(25,26)19-12-10-9-11-13-19/h9-13,15-17,20,22H,14H2,1-8H3/t16-,17-,20+,22+/m1/s1 |
| InChIKey | OKQDESBWJCRWMH-ODHOGUPTSA-N |
| XLogP | 5.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|