C20H13BrF4N4O — CID 139118084
(NE)-N-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylidene]hydroxylamine;1-methyl-2-pyridin-4-ylbenzimidazole (PubChem CID 139118084) has the molecular formula C20H13BrF4N4O and a molecular weight of 481.25 g/mol. Its IUPAC name is (NE)-N-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylidene]hydroxylamine;1-methyl-2-pyridin-4-ylbenzimidazole.
| Compound Name | (NE)-N-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylidene]hydroxylamine;1-methyl-2-pyridin-4-ylbenzimidazole |
|---|---|
| PubChem CID | 139118084 |
| Molecular Formula | C20H13BrF4N4O |
| Molecular Weight | 481.25 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | (NE)-N-[(4-bromo-2,3,5,6-tetrafluorophenyl)methylidene]hydroxylamine;1-methyl-2-pyridin-4-ylbenzimidazole |
| SMILES | Cn1c(-c2ccncc2)nc2ccccc21.O/N=C/c1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C13H11N3.C7H2BrF4NO/c1-16-12-5-3-2-4-11(12)15-13(16)10-6-8-14-9-7-10;8-3-6(11)4(9)2(1-13-14)5(10)7(3)12/h2-9H,1H3;1,14H/b;13-1+ |
| InChIKey | MVGQENBLORUBTJ-LKFSGRKCSA-N |
| XLogP | 5.45 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|