About dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate
dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate (PubChem CID 139118447) has the molecular formula C27H63Mg2N3OSi6
and a molecular weight of 662.95 g/mol. Its IUPAC name is dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate.
Molecular Properties
| Compound Name | dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate |
| PubChem CID | 139118447 |
| Molecular Formula | C27H63Mg2N3OSi6 |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate |
| SMILES | C/C=C(\[O-])c1ccccc1.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Mg+2].[Mg+2] |
| InChI | InChI=1S/C9H10O.3C6H18NSi2.2Mg/c1-2-9(10)8-6-4-3-5-7-8;3*1-8(2,3)7-9(4,5)6;;/h2-7,10H,1H3;3*1-6H3;;/q;3*-1;2*+2/p-1/b9-2-;;;;; |
| InChIKey | QYDCPVSCEGZCIM-HFCFNBBXSA-M |
| XLogP | 9.74 |
| TPSA | 65.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate?
The IUPAC name of dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate (CID 139118447) is dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate.
What is the SMILES notation for dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate?
The canonical SMILES for dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate is C/C=C(\[O-])c1ccccc1.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate?
The InChIKey is QYDCPVSCEGZCIM-HFCFNBBXSA-M. The full InChI is InChI=1S/C9H10O.3C6H18NSi2.2Mg/c1-2-9(10)8-6-4-3-5-7-8;3*1-8(2,3)7-9(4,5)6;;/h2-7,10H,1H3;3*1-6H3;;/q;3*-1;2*+2/p-1/b9-2-;;;;;.
What are the key properties of dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate?
dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate has a molecular weight of 662.95 g/mol, XLogP of 9.74, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;tris(bis(trimethylsilyl)azanide);(Z)-1-phenylprop-1-en-1-olate is sourced from PubChem (CID 139118447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).