C18H23IO2S — CID 139119559
(1R,2R,4R)-2-[(E)-1-iodo-2-[(R)-phenylsulfinyl]ethenyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 139119559) has the molecular formula C18H23IO2S and a molecular weight of 430.35 g/mol. Its IUPAC name is (1R,2R,4R)-2-[(E)-1-iodo-2-[(R)-phenylsulfinyl]ethenyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4R)-2-[(E)-1-iodo-2-[(R)-phenylsulfinyl]ethenyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 139119559 |
| Molecular Formula | C18H23IO2S |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (1R,2R,4R)-2-[(E)-1-iodo-2-[(R)-phenylsulfinyl]ethenyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(/C(I)=C\[S@@](=O)c1ccccc1)C2 |
| InChI | InChI=1S/C18H23IO2S/c1-16(2)13-9-10-17(16,3)18(20,11-13)15(19)12-22(21)14-7-5-4-6-8-14/h4-8,12-13,20H,9-11H2,1-3H3/b15-12+/t13-,17-,18+,22-/m1/s1 |
| InChIKey | SGJDLJABGXMPSR-LIZCIFBHSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|