C21H21N3O4 — CID 139119717
(13bR)-2-benzyl-13b-hydroxy-5-methyl-4,7-dihydro-1H-[1,4,7]triazonino[2,1-a]isoindole-3,6,9-trione (PubChem CID 139119717) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (13bR)-2-benzyl-13b-hydroxy-5-methyl-4,7-dihydro-1H-[1,4,7]triazonino[2,1-a]isoindole-3,6,9-trione.
| Compound Name | (13bR)-2-benzyl-13b-hydroxy-5-methyl-4,7-dihydro-1H-[1,4,7]triazonino[2,1-a]isoindole-3,6,9-trione |
|---|---|
| PubChem CID | 139119717 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (13bR)-2-benzyl-13b-hydroxy-5-methyl-4,7-dihydro-1H-[1,4,7]triazonino[2,1-a]isoindole-3,6,9-trione |
| SMILES | CN1CC(=O)N(Cc2ccccc2)C[C@]2(O)c3ccccc3C(=O)N2CC1=O |
| InChI | InChI=1S/C21H21N3O4/c1-22-12-19(26)23(11-15-7-3-2-4-8-15)14-21(28)17-10-6-5-9-16(17)20(27)24(21)13-18(22)25/h2-10,28H,11-14H2,1H3/t21-/m0/s1 |
| InChIKey | GTNVGCCJKFCRPK-NRFANRHFSA-N |
| XLogP | 0.79 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |