C48H46N10 — CID 139119939
2-N-benzyl-6-N-[6-(benzylamino)-2-pyridinyl]pyridine-2,6-diamine (PubChem CID 139119939) has the molecular formula C48H46N10 and a molecular weight of 762.97 g/mol. Its IUPAC name is 2-N-benzyl-6-N-[6-(benzylamino)-2-pyridinyl]pyridine-2,6-diamine.
| Compound Name | 2-N-benzyl-6-N-[6-(benzylamino)-2-pyridinyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 139119939 |
| Molecular Formula | C48H46N10 |
| Molecular Weight | 762.97 g/mol |
| Exact Mass | 762.39 |
| IUPAC Name | 2-N-benzyl-6-N-[6-(benzylamino)-2-pyridinyl]pyridine-2,6-diamine |
| SMILES | c1ccc(CNc2cccc(Nc3cccc(NCc4ccccc4)n3)n2)cc1.c1ccc(CNc2cccc(Nc3cccc(NCc4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/2C24H23N5/c2*1-3-9-19(10-4-1)17-25-21-13-7-15-23(27-21)29-24-16-8-14-22(28-24)26-18-20-11-5-2-6-12-20/h2*1-16H,17-18H2,(H3,25,26,27,28,29) |
| InChIKey | CZHJHKYKCMIRGX-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.97 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |