C35H28F12N2O5 — CID 139121215
acetonitrile;tert-butyl (1R,2R)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate (PubChem CID 139121215) has the molecular formula C35H28F12N2O5 and a molecular weight of 784.59 g/mol. Its IUPAC name is acetonitrile;tert-butyl (1R,2R)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate.
| Compound Name | acetonitrile;tert-butyl (1R,2R)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139121215 |
| Molecular Formula | C35H28F12N2O5 |
| Molecular Weight | 784.59 g/mol |
| Exact Mass | 784.18 |
| IUPAC Name | acetonitrile;tert-butyl (1R,2R)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
| SMILES | CC#N.CC(C)(C)OC(=O)[C@@]1(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCc2ccccc2[C@H]1OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H25F12NO5.C2H3N/c1-28(2,3)51-27(49)29(46-25(47)17-10-19(30(34,35)36)14-20(11-17)31(37,38)39)9-8-16-6-4-5-7-23(16)24(29)50-26(48)18-12-21(32(40,41)42)15-22(13-18)33(43,44)45;1-2-3/h4-7,10-15,24H,8-9H2,1-3H3,(H,46,47);1H3/t24-,29-;/m1./s1 |
| InChIKey | JDXGHNQJLRVRMT-VOPILSCNSA-N |
| XLogP | 9.65 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.59 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |