C21H19N3O4 — CID 139121601
5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine (PubChem CID 139121601) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine.
| Compound Name | 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine |
|---|---|
| PubChem CID | 139121601 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine |
| SMILES | O=[N+]([O-])C[C@@H](c1ccccc1)[C@H](Cc1ccccc1)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C21H19N3O4/c25-23(26)15-20(17-9-5-2-6-10-17)19(13-16-7-3-1-4-8-16)21-12-11-18(14-22-21)24(27)28/h1-12,14,19-20H,13,15H2/t19-,20-/m0/s1 |
| InChIKey | CORDCDVGJMZLQJ-PMACEKPBSA-N |
| XLogP | 4.38 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|