About [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate
[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate (PubChem CID 139122663) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate.
Analyze [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The IUPAC name of [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate (CID 139122663) is [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate.
What is the SMILES notation for [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The canonical SMILES for [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate is CC(=O)O[C@@]1(C)C=CC=CC1=O.
What is the InChIKey of [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate?
The InChIKey is LBWDXFLTCORELZ-VIFPVBQESA-N. The full InChI is InChI=1S/C9H10O3/c1-7(10)12-9(2)6-4-3-5-8(9)11/h3-6H,1-2H3/t9-/m0/s1.
What are the key properties of [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate?
[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate has a molecular weight of 166.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl] acetate is sourced from PubChem (CID 139122663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).