C32H32N8O7 — CID 139122907
(2R)-2-hydroxy-2-phenylacetic acid;tetrakis(pyridine-3-carboxamide) (PubChem CID 139122907) has the molecular formula C32H32N8O7 and a molecular weight of 640.66 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phenylacetic acid;tetrakis(pyridine-3-carboxamide).
| Compound Name | (2R)-2-hydroxy-2-phenylacetic acid;tetrakis(pyridine-3-carboxamide) |
|---|---|
| PubChem CID | 139122907 |
| Molecular Formula | C32H32N8O7 |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (2R)-2-hydroxy-2-phenylacetic acid;tetrakis(pyridine-3-carboxamide) |
| SMILES | NC(=O)c1cccnc1.NC(=O)c1cccnc1.NC(=O)c1cccnc1.NC(=O)c1cccnc1.O=C(O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H8O3.4C6H6N2O/c9-7(8(10)11)6-4-2-1-3-5-6;4*7-6(9)5-2-1-3-8-4-5/h1-5,7,9H,(H,10,11);4*1-4H,(H2,7,9)/t7-;;;;/m1..../s1 |
| InChIKey | TTXPEVQXHLAGTJ-GITXNKFESA-N |
| XLogP | 1.53 |
| TPSA | 281.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |