C27H28ClNO6S — CID 139123220
3a-O-ethyl 1-O-methyl (1R,3R,3aR,8aR)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1,3a-dicarboxylate (PubChem CID 139123220) has the molecular formula C27H28ClNO6S and a molecular weight of 530.04 g/mol. Its IUPAC name is 3a-O-ethyl 1-O-methyl (1R,3R,3aR,8aR)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1,3a-dicarboxylate.
| Compound Name | 3a-O-ethyl 1-O-methyl (1R,3R,3aR,8aR)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1,3a-dicarboxylate |
|---|---|
| PubChem CID | 139123220 |
| Molecular Formula | C27H28ClNO6S |
| Molecular Weight | 530.04 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3a-O-ethyl 1-O-methyl (1R,3R,3aR,8aR)-3-(4-chlorophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1,3a-dicarboxylate |
| SMILES | CCOC(=O)[C@]12C=CC=CC[C@H]1[C@H](C(=O)OC)N(S(=O)(=O)c1ccc(C)cc1)[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28ClNO6S/c1-4-35-26(31)27-17-7-5-6-8-22(27)23(25(30)34-3)29(24(27)19-11-13-20(28)14-12-19)36(32,33)21-15-9-18(2)10-16-21/h5-7,9-17,22-24H,4,8H2,1-3H3/t22-,23+,24+,27+/m0/s1 |
| InChIKey | VMAGLCVEHNEKKR-ZOJNDGCKSA-N |
| XLogP | 4.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.04 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |