C32H26N6O — CID 139123330
N-[4-[4-(pyridin-2-ylmethylideneamino)-N-[4-(pyridin-2-ylmethylideneamino)phenyl]anilino]phenyl]acetamide (PubChem CID 139123330) has the molecular formula C32H26N6O and a molecular weight of 510.60 g/mol. Its IUPAC name is N-[4-[4-(pyridin-2-ylmethylideneamino)-N-[4-(pyridin-2-ylmethylideneamino)phenyl]anilino]phenyl]acetamide.
| Compound Name | N-[4-[4-(pyridin-2-ylmethylideneamino)-N-[4-(pyridin-2-ylmethylideneamino)phenyl]anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 139123330 |
| Molecular Formula | C32H26N6O |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | N-[4-[4-(pyridin-2-ylmethylideneamino)-N-[4-(pyridin-2-ylmethylideneamino)phenyl]anilino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(c2ccc(/N=C/c3ccccn3)cc2)c2ccc(/N=C/c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C32H26N6O/c1-24(39)37-27-12-18-32(19-13-27)38(30-14-8-25(9-15-30)35-22-28-6-2-4-20-33-28)31-16-10-26(11-17-31)36-23-29-7-3-5-21-34-29/h2-23H,1H3,(H,37,39)/b35-22+,36-23+ |
| InChIKey | MNGJGQPQTUWDCA-DGWFLTEHSA-N |
| XLogP | 7.41 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|