C31H29N — CID 139123608
(2S)-1-[(E)-2-phenylethenyl]-2-tritylpyrrolidine (PubChem CID 139123608) has the molecular formula C31H29N and a molecular weight of 415.58 g/mol. Its IUPAC name is (2S)-1-[(E)-2-phenylethenyl]-2-tritylpyrrolidine.
| Compound Name | (2S)-1-[(E)-2-phenylethenyl]-2-tritylpyrrolidine |
|---|---|
| PubChem CID | 139123608 |
| Molecular Formula | C31H29N |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (2S)-1-[(E)-2-phenylethenyl]-2-tritylpyrrolidine |
| SMILES | C(=C/N1CCC[C@H]1C(c1ccccc1)(c1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C31H29N/c1-5-14-26(15-6-1)23-25-32-24-13-22-30(32)31(27-16-7-2-8-17-27,28-18-9-3-10-19-28)29-20-11-4-12-21-29/h1-12,14-21,23,25,30H,13,22,24H2/b25-23+/t30-/m0/s1 |
| InChIKey | XDTNJCHVNRPULS-LWPAWRQISA-N |
| XLogP | 7.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|