C20H18B2N4O4S — CID 139125199
(5-boronothiophen-2-yl)boronic acid;bis(1,8-naphthyridine) (PubChem CID 139125199) has the molecular formula C20H18B2N4O4S and a molecular weight of 432.08 g/mol. Its IUPAC name is (5-boronothiophen-2-yl)boronic acid;bis(1,8-naphthyridine).
| Compound Name | (5-boronothiophen-2-yl)boronic acid;bis(1,8-naphthyridine) |
|---|---|
| PubChem CID | 139125199 |
| Molecular Formula | C20H18B2N4O4S |
| Molecular Weight | 432.08 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (5-boronothiophen-2-yl)boronic acid;bis(1,8-naphthyridine) |
| SMILES | OB(O)c1ccc(B(O)O)s1.c1cnc2ncccc2c1.c1cnc2ncccc2c1 |
| InChI | InChI=1S/2C8H6N2.C4H6B2O4S/c2*1-3-7-4-2-6-10-8(7)9-5-1;7-5(8)3-1-2-4(11-3)6(9)10/h2*1-6H;1-2,7-10H |
| InChIKey | RXYMIWCBYIXPAJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.08 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|