C12H8N2S — CID 132535078
3-thiophen-3-yl-1,8-naphthyridine (PubChem CID 132535078) has the molecular formula C12H8N2S and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-thiophen-3-yl-1,8-naphthyridine.
| Compound Name | 3-thiophen-3-yl-1,8-naphthyridine |
|---|---|
| PubChem CID | 132535078 |
| Molecular Formula | C12H8N2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-thiophen-3-yl-1,8-naphthyridine |
| SMILES | c1cnc2ncc(-c3ccsc3)cc2c1 |
| InChI | InChI=1S/C12H8N2S/c1-2-9-6-11(10-3-5-15-8-10)7-14-12(9)13-4-1/h1-8H |
| InChIKey | NTOPJSVECOEMFG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |