C14H12BBrN2O2 — CID 139125207
(4-bromophenyl)boronic acid;1,8-naphthyridine (PubChem CID 139125207) has the molecular formula C14H12BBrN2O2 and a molecular weight of 330.98 g/mol. Its IUPAC name is (4-bromophenyl)boronic acid;1,8-naphthyridine.
| Compound Name | (4-bromophenyl)boronic acid;1,8-naphthyridine |
|---|---|
| PubChem CID | 139125207 |
| Molecular Formula | C14H12BBrN2O2 |
| Molecular Weight | 330.98 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (4-bromophenyl)boronic acid;1,8-naphthyridine |
| SMILES | OB(O)c1ccc(Br)cc1.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C6H6BBrO2/c1-3-7-4-2-6-10-8(7)9-5-1;8-6-3-1-5(2-4-6)7(9)10/h1-6H;1-4,9-10H |
| InChIKey | AEQMAEZWSUOBNU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.98 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|