C25H34O4 — CID 139125647
2-tert-butyl-5-[(1S)-1-(4-tert-butyl-2,5-dihydroxyphenyl)-2,2-dimethylpropyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 139125647) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2-tert-butyl-5-[(1S)-1-(4-tert-butyl-2,5-dihydroxyphenyl)-2,2-dimethylpropyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-tert-butyl-5-[(1S)-1-(4-tert-butyl-2,5-dihydroxyphenyl)-2,2-dimethylpropyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139125647 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2-tert-butyl-5-[(1S)-1-(4-tert-butyl-2,5-dihydroxyphenyl)-2,2-dimethylpropyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)C([C@H](c2cc(O)c(C(C)(C)C)cc2O)C(C)(C)C)=CC1=O |
| InChI | InChI=1S/C25H34O4/c1-23(2,3)16-12-18(26)14(10-20(16)28)22(25(7,8)9)15-11-21(29)17(13-19(15)27)24(4,5)6/h10-13,22,26,28H,1-9H3/t22-/m0/s1 |
| InChIKey | LHIGZXQDWNHBFZ-QFIPXVFZSA-N |
| XLogP | 5.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|