C16H24O4 — CID 139125788
methyl (2R)-2-[(1S,2R,8aR)-1,2,5-trimethyl-4-oxo-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-2-hydroxyacetate (PubChem CID 139125788) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (2R)-2-[(1S,2R,8aR)-1,2,5-trimethyl-4-oxo-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-2-hydroxyacetate.
| Compound Name | methyl (2R)-2-[(1S,2R,8aR)-1,2,5-trimethyl-4-oxo-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 139125788 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (2R)-2-[(1S,2R,8aR)-1,2,5-trimethyl-4-oxo-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@H](O)[C@@]1(C)[C@H](C)CC(=O)C2=C(C)CCC[C@@H]21 |
| InChI | InChI=1S/C16H24O4/c1-9-6-5-7-11-13(9)12(17)8-10(2)16(11,3)14(18)15(19)20-4/h10-11,14,18H,5-8H2,1-4H3/t10-,11+,14+,16+/m1/s1 |
| InChIKey | KKZBYKHVICEQMF-AZLWOZFGSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |