C20H20N2O5 — CID 139125969
methyl (2S,3S)-2-methyl-2-[(4-nitrobenzoyl)amino]-3-phenylpent-4-enoate (PubChem CID 139125969) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl (2S,3S)-2-methyl-2-[(4-nitrobenzoyl)amino]-3-phenylpent-4-enoate.
| Compound Name | methyl (2S,3S)-2-methyl-2-[(4-nitrobenzoyl)amino]-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 139125969 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | methyl (2S,3S)-2-methyl-2-[(4-nitrobenzoyl)amino]-3-phenylpent-4-enoate |
| SMILES | C=C[C@@H](c1ccccc1)[C@](C)(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C20H20N2O5/c1-4-17(14-8-6-5-7-9-14)20(2,19(24)27-3)21-18(23)15-10-12-16(13-11-15)22(25)26/h4-13,17H,1H2,2-3H3,(H,21,23)/t17-,20-/m0/s1 |
| InChIKey | FXWWFAYCRIWABY-PXNSSMCTSA-N |
| XLogP | 3.23 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|