C34H47F3N4O3SSe — CID 139126434
(Z)-N'-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]selanyl-N-tert-butylethane-1,2-diimine;trifluoromethanesulfonate (PubChem CID 139126434) has the molecular formula C34H47F3N4O3SSe and a molecular weight of 727.80 g/mol. Its IUPAC name is (Z)-N'-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]selanyl-N-tert-butylethane-1,2-diimine;trifluoromethanesulfonate.
| Compound Name | (Z)-N'-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]selanyl-N-tert-butylethane-1,2-diimine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139126434 |
| Molecular Formula | C34H47F3N4O3SSe |
| Molecular Weight | 727.80 g/mol |
| Exact Mass | 728.25 |
| IUPAC Name | (Z)-N'-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-2-yl]selanyl-N-tert-butylethane-1,2-diimine;trifluoromethanesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1[Se]/N=C\C=N\C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C33H47N4Se.CHF3O3S/c1-22(2)26-14-12-15-27(23(3)4)30(26)36-20-21-37(32(36)38-35-19-18-34-33(9,10)11)31-28(24(5)6)16-13-17-29(31)25(7)8;2-1(3,4)8(5,6)7/h12-25H,1-11H3;(H,5,6,7)/q+1;/p-1/b34-18+,35-19-; |
| InChIKey | SDIDVNUVRDZKNC-SDZAUYNZSA-M |
| XLogP | 7.48 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|