C25H26N2O2 — CID 139127101
2-(4,5-diphenyl-1H-imidazol-2-yl)-4,6-dimethylphenol;ethanol (PubChem CID 139127101) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1H-imidazol-2-yl)-4,6-dimethylphenol;ethanol.
| Compound Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-4,6-dimethylphenol;ethanol |
|---|---|
| PubChem CID | 139127101 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-4,6-dimethylphenol;ethanol |
| SMILES | CCO.Cc1cc(C)c(O)c(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C23H20N2O.C2H6O/c1-15-13-16(2)22(26)19(14-15)23-24-20(17-9-5-3-6-10-17)21(25-23)18-11-7-4-8-12-18;1-2-3/h3-14,26H,1-2H3,(H,24,25);3H,2H2,1H3 |
| InChIKey | CVMBZSIVNAXPJP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|