About [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate
[(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate (PubChem CID 139127315) has the molecular formula C5H11ClN6O
and a molecular weight of 206.64 g/mol. Its IUPAC name is [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate.
Molecular Properties
| Compound Name | [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate |
| PubChem CID | 139127315 |
| Molecular Formula | C5H11ClN6O |
| Molecular Weight | 206.64 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate |
| SMILES | NC(N)=NC(=[NH2+])n1cccn1.O.[Cl-] |
| InChI | InChI=1S/C5H8N6.ClH.H2O/c6-4(7)10-5(8)11-3-1-2-9-11;;/h1-3H,(H5,6,7,8,10);1H;1H2 |
| InChIKey | RQCLHFZXNRAESG-UHFFFAOYSA-N |
| XLogP | -6.70 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.64 |
| LogP ≤ 5 | -6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate?
The IUPAC name of [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate (CID 139127315) is [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate.
What is the SMILES notation for [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate?
The canonical SMILES for [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate is NC(N)=NC(=[NH2+])n1cccn1.O.[Cl-].
What is the InChIKey of [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate?
The InChIKey is RQCLHFZXNRAESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6.ClH.H2O/c6-4(7)10-5(8)11-3-1-2-9-11;;/h1-3H,(H5,6,7,8,10);1H;1H2.
What are the key properties of [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate?
[(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate has a molecular weight of 206.64 g/mol, XLogP of -6.70, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(diaminomethylideneamino)-pyrazol-1-ylmethylidene]azanium;chloride;hydrate is sourced from PubChem (CID 139127315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).