About osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide)
osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) (PubChem CID 139127812) has the molecular formula C34H26N8Os
and a molecular weight of 736.87 g/mol. Its IUPAC name is osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide).
Molecular Properties
| Compound Name | osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) |
| PubChem CID | 139127812 |
| Molecular Formula | C34H26N8Os |
| Molecular Weight | 736.87 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) |
| SMILES | [Os+2].c1ccc([N-]c2ccccc2/N=N/c2ccccn2)cc1.c1ccc([N-]c2ccccc2/N=N/c2ccccn2)cc1 |
| InChI | InChI=1S/2C17H13N4.Os/c2*1-2-8-14(9-3-1)19-15-10-4-5-11-16(15)20-21-17-12-6-7-13-18-17;/h2*1-13H;/q2*-1;+2/b2*21-20+; |
| InChIKey | QYNLZRDTUDWKNK-SQMNQOOUSA-N |
| XLogP | 11.67 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 736.87 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide)?
The IUPAC name of osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) (CID 139127812) is osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide).
What is the SMILES notation for osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide)?
The canonical SMILES for osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) is [Os+2].c1ccc([N-]c2ccccc2/N=N/c2ccccn2)cc1.c1ccc([N-]c2ccccc2/N=N/c2ccccn2)cc1.
What is the InChIKey of osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide)?
The InChIKey is QYNLZRDTUDWKNK-SQMNQOOUSA-N. The full InChI is InChI=1S/2C17H13N4.Os/c2*1-2-8-14(9-3-1)19-15-10-4-5-11-16(15)20-21-17-12-6-7-13-18-17;/h2*1-13H;/q2*-1;+2/b2*21-20+;.
What are the key properties of osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide)?
osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) has a molecular weight of 736.87 g/mol, XLogP of 11.67, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for osmium(2+);bis(phenyl-[2-(pyridin-2-yldiazenyl)phenyl]azanide) is sourced from PubChem (CID 139127812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).