C48H54N4O2Zn — CID 139131610
zinc;[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-quinolin-8-ylazanide;2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate (PubChem CID 139131610) has the molecular formula C48H54N4O2Zn and a molecular weight of 784.38 g/mol. Its IUPAC name is zinc;[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-quinolin-8-ylazanide;2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate.
| Compound Name | zinc;[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-quinolin-8-ylazanide;2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate |
|---|---|
| PubChem CID | 139131610 |
| Molecular Formula | C48H54N4O2Zn |
| Molecular Weight | 784.38 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | zinc;[(Z)-(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-quinolin-8-ylazanide;2,4-ditert-butyl-6-(quinolin-8-yliminomethyl)phenolate |
| SMILES | CC(C)(C)C1=C/C(=C/[N-]c2cccc3cccnc23)C(=O)C(C(C)(C)C)=C1.CC(C)(C)c1cc(C=Nc2cccc3cccnc23)c([O-])c(C(C)(C)C)c1.[Zn+2] |
| InChI | InChI=1S/2C24H28N2O.Zn/c2*1-23(2,3)18-13-17(22(27)19(14-18)24(4,5)6)15-26-20-11-7-9-16-10-8-12-25-21(16)20;/h7-15H,1-6H3,(H,26,27);7-15,27H,1-6H3;/q;;+2/p-2 |
| InChIKey | APQOXGZZVVWWAR-UHFFFAOYSA-L |
| XLogP | 12.30 |
| TPSA | 92.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.38 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|