C24H18F6N2O6S3 — CID 139132429
4-phenyl-1-(4-phenylpyridin-1-ium-1-yl)sulfanylpyridin-1-ium;bis(trifluoromethanesulfonate) (PubChem CID 139132429) has the molecular formula C24H18F6N2O6S3 and a molecular weight of 640.61 g/mol. Its IUPAC name is 4-phenyl-1-(4-phenylpyridin-1-ium-1-yl)sulfanylpyridin-1-ium;bis(trifluoromethanesulfonate).
| Compound Name | 4-phenyl-1-(4-phenylpyridin-1-ium-1-yl)sulfanylpyridin-1-ium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139132429 |
| Molecular Formula | C24H18F6N2O6S3 |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 640.02 |
| IUPAC Name | 4-phenyl-1-(4-phenylpyridin-1-ium-1-yl)sulfanylpyridin-1-ium;bis(trifluoromethanesulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cc[n+](S[n+]3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18N2S.2CHF3O3S/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20;2*2-1(3,4)8(5,6)7/h1-18H;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | CZAVSKICQNEPGP-UHFFFAOYSA-L |
| XLogP | 4.66 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|