C33H38N4O4Zn — CID 139133616
zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;4-nitrophenolate (PubChem CID 139133616) has the molecular formula C33H38N4O4Zn and a molecular weight of 620.08 g/mol. Its IUPAC name is zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;4-nitrophenolate.
| Compound Name | zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;4-nitrophenolate |
|---|---|
| PubChem CID | 139133616 |
| Molecular Formula | C33H38N4O4Zn |
| Molecular Weight | 620.08 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | zinc;2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4,6-ditert-butylphenolate;4-nitrophenolate |
| SMILES | CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c([O-])c(C(C)(C)C)c1.O=[N+]([O-])c1ccc([O-])cc1.[Zn+2] |
| InChI | InChI=1S/C27H35N3O.C6H5NO3.Zn/c1-26(2,3)21-15-20(25(31)24(16-21)27(4,5)6)17-30(18-22-11-7-9-13-28-22)19-23-12-8-10-14-29-23;8-6-3-1-5(2-4-6)7(9)10;/h7-16,31H,17-19H2,1-6H3;1-4,8H;/q;;+2/p-2 |
| InChIKey | KQNQVUFAQJFNLJ-UHFFFAOYSA-L |
| XLogP | 6.01 |
| TPSA | 118.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.08 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|