C50H41BFeN6O2 — CID 139136445
iron(2+);(Z)-4-oxopent-2-en-2-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide (PubChem CID 139136445) has the molecular formula C50H41BFeN6O2 and a molecular weight of 824.58 g/mol. Its IUPAC name is iron(2+);(Z)-4-oxopent-2-en-2-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide.
| Compound Name | iron(2+);(Z)-4-oxopent-2-en-2-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide |
|---|---|
| PubChem CID | 139136445 |
| Molecular Formula | C50H41BFeN6O2 |
| Molecular Weight | 824.58 g/mol |
| Exact Mass | 824.27 |
| IUPAC Name | iron(2+);(Z)-4-oxopent-2-en-2-olate;tris(3,5-diphenylpyrazol-1-yl)boranuide |
| SMILES | CC(=O)/C=C(/C)[O-].[Fe+2].c1ccc(-c2cc(-c3ccccc3)n([BH-](n3nc(-c4ccccc4)cc3-c3ccccc3)n3nc(-c4ccccc4)cc3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H34BN6.C5H8O2.Fe/c1-7-19-34(20-8-1)40-31-43(37-25-13-4-14-26-37)50(47-40)46(51-44(38-27-15-5-16-28-38)32-41(48-51)35-21-9-2-10-22-35)52-45(39-29-17-6-18-30-39)33-42(49-52)36-23-11-3-12-24-36;1-4(6)3-5(2)7;/h1-33,46H;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | ZGFGOMFRYMKEGR-LWFKIUJUSA-M |
| XLogP | 9.78 |
| TPSA | 93.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.58 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|